CAS 1932047-08-9 is the registry number for Methyl (1S,3R)-3-(bromomethyl)cyclohexane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-methyl (1S,3R)-3-(bromomethyl)cyclohexane-1-carboxylate (CAS 1932047-08-9) is a chemical compound with the molecular formula C9H15BrO2 and a molecular weight of 235.12 g/mol. IUPAC name: cis-methyl (1S,3R)-3-(bromomethyl)cyclohexane-1-carboxylate. InChIKey: KYURAIYPHVBBMO-SFYZADRCSA-N.
| Molecular formula | C9H15BrO2 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-(bromomethyl)cyclohexane-1-carboxylate |
| InChIKey | KYURAIYPHVBBMO-SFYZADRCSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H](C1)CBr |
Computed by PubChem (NCBI)