CAS 1932059-37-4 is the registry number for Ethyl (1S,2S)-2-bromocyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-ethyl (1S,2S)-2-bromocyclopropane-1-carboxylate (CAS 1932059-37-4) is a chemical compound with the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. IUPAC name: cis-ethyl (1S,2S)-2-bromocyclopropane-1-carboxylate. InChIKey: SAZVRBIIIQJYQT-UHNVWZDZSA-N.
| Molecular formula | C6H9BrO2 |
|---|---|
| Molecular weight | 193.04 g/mol |
| IUPAC name | cis-ethyl (1S,2S)-2-bromocyclopropane-1-carboxylate |
| InChIKey | SAZVRBIIIQJYQT-UHNVWZDZSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]1Br |
Computed by PubChem (NCBI)