CAS 1932097-33-0 is the registry number for 1,6-Naphthyridine-6(2H)-carboxylic acid, octahydro-, 1,1-dimethylethyl ester, (4aR,8aR)-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine-6-carboxylate (CAS 1932097-33-0) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl (4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine-6-carboxylate. InChIKey: WHVRANRQYMSGMH-GHMZBOCLSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl (4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine-6-carboxylate |
| InChIKey | WHVRANRQYMSGMH-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@@H](C1)CCCN2 |
Computed by PubChem (NCBI)