CAS 1932146-05-8 is the registry number for (R)-4-(Trifluoromethyl)oxazolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-4-(trifluoromethyl)-1,3-oxazolidin-2-one (CAS 1932146-05-8) is a chemical compound with the molecular formula C4H4F3NO2 and a molecular weight of 155.08 g/mol. IUPAC name: (4R)-4-(trifluoromethyl)-1,3-oxazolidin-2-one. InChIKey: AOOOOLXZRHYHCP-UWTATZPHSA-N.
| Molecular formula | C4H4F3NO2 |
|---|---|
| Molecular weight | 155.08 g/mol |
| IUPAC name | (4R)-4-(trifluoromethyl)-1,3-oxazolidin-2-one |
| InChIKey | AOOOOLXZRHYHCP-UWTATZPHSA-N |
| SMILES | C1[C@@H](NC(=O)O1)C(F)(F)F |
Computed by PubChem (NCBI)