CAS 1932168-90-5 is the registry number for tert-Butyl (1S,5R)-2,6-diazabicyclo(3.2.1)octane-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl (1S,5R)-2,6-diazabicyclo[3.2.1]octane-2-carboxylate (CAS 1932168-90-5) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1S,5R)-2,6-diazabicyclo[3.2.1]octane-2-carboxylate. InChIKey: XRDBVKRCVDIYCZ-BDAKNGLRSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1S,5R)-2,6-diazabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | XRDBVKRCVDIYCZ-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2C[C@H]1CN2 |
Computed by PubChem (NCBI)