CAS 1932302-33-4 is the registry number for 1H-Azepine-1-carboxylic acid, 4,5-diaminohexahydro-, 1,1-dimethylethyl ester, (4R,5R)-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4R,5R)-4,5-diaminoazepane-1-carboxylate (CAS 1932302-33-4) is a chemical compound with the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (4R,5R)-4,5-diaminoazepane-1-carboxylate. InChIKey: AGZUCISAMZDBQC-RKDXNWHRSA-N.
| Molecular formula | C11H23N3O2 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (4R,5R)-4,5-diaminoazepane-1-carboxylate |
| InChIKey | AGZUCISAMZDBQC-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](CC1)N)N |
Computed by PubChem (NCBI)