CAS 1932333-08-8 is the registry number for (3S,4R)-4-Cyclopentylpyrrolidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-cyclopentylpyrrolidin-3-ol (CAS 1932333-08-8) is a chemical compound with the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. IUPAC name: (3S,4R)-4-cyclopentylpyrrolidin-3-ol. InChIKey: RFXPATVGGGEOCZ-DTWKUNHWSA-N.
| Molecular formula | C9H17NO |
|---|---|
| Molecular weight | 155.24 g/mol |
| IUPAC name | (3S,4R)-4-cyclopentylpyrrolidin-3-ol |
| InChIKey | RFXPATVGGGEOCZ-DTWKUNHWSA-N |
| SMILES | C1CCC(C1)[C@@H]2CNC[C@H]2O |
Computed by PubChem (NCBI)