CAS 1932367-57-1 appears in our catalog under these names: Rac-(3ar,7as)-5-methyloctahydro-4h-pyrrolo[3,4-c]pyridin-4-one, 95%, Rac-(3aR,7aS)-5-methyloctahydro-4H-pyrrolo(3,4-c)pyridin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
(3aR,7aS)-5-methyl-2,3,3a,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one (CAS 1932367-57-1) is a chemical compound with the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. IUPAC name: (3aR,7aS)-5-methyl-2,3,3a,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one. InChIKey: WMDTZODKQITGAM-RQJHMYQMSA-N.
| Molecular formula | C8H14N2O |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | (3aR,7aS)-5-methyl-2,3,3a,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one |
| InChIKey | WMDTZODKQITGAM-RQJHMYQMSA-N |
| SMILES | CN1CC[C@@H]2CNC[C@@H]2C1=O |
Computed by PubChem (NCBI)