CAS 1932410-20-2 is the registry number for (3AS,6aS)-hexahydrocyclopenta[c]pyrrole-3a(1H)-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3a-carboxylic acid (CAS 1932410-20-2) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3a-carboxylic acid. InChIKey: JTTVKCQDFDFKRG-HTRCEHHLSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (3aS,6aS)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3a-carboxylic acid |
| InChIKey | JTTVKCQDFDFKRG-HTRCEHHLSA-N |
| SMILES | C1C[C@@H]2CNC[C@@]2(C1)C(=O)O |
Computed by PubChem (NCBI)