Products 1932430-32-4
CAS 1932430-32-4 is the registry number for (R)-2-Amino-2-(5-ethynylpyridin-2-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-(5-ethynyl-2-pyridinyl)ethanol (CAS 1932430-32-4) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: (2R)-2-amino-2-(5-ethynyl-2-pyridinyl)ethanol. InChIKey: GAWNVVDTDBPERS-QMMMGPOBSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | (2R)-2-amino-2-(5-ethynyl-2-pyridinyl)ethanol |
| InChIKey | GAWNVVDTDBPERS-QMMMGPOBSA-N |
| SMILES | C#CC1=CN=C(C=C1)[C@H](CO)N |
Computed by PubChem (NCBI)