CAS 1932447-76-1 is the registry number for (3R,4S)-3-Amino-4-hydroxytetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-amino-1,1-dioxothiolan-3-ol (CAS 1932447-76-1) is a chemical compound with the molecular formula C4H9NO3S and a molecular weight of 151.19 g/mol. IUPAC name: (3S,4R)-4-amino-1,1-dioxothiolan-3-ol. InChIKey: REXPOWCRPFUCHS-IUYQGCFVSA-N.
| Molecular formula | C4H9NO3S |
|---|---|
| Molecular weight | 151.19 g/mol |
| IUPAC name | (3S,4R)-4-amino-1,1-dioxothiolan-3-ol |
| InChIKey | REXPOWCRPFUCHS-IUYQGCFVSA-N |
| SMILES | C1[C@@H]([C@@H](CS1(=O)=O)O)N |
Computed by PubChem (NCBI)