CAS 1932466-88-0 is the registry number for tert-Butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate (CAS 1932466-88-0) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate. InChIKey: SEBKQWOUTPGSCS-GHMZBOCLSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl (1R,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate |
| InChIKey | SEBKQWOUTPGSCS-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCC[C@@H]1CNC2 |
Computed by PubChem (NCBI)