CAS 1932484-68-8 appears in our catalog under these names: 4-(tert-Butyl) 2-methyl (S)-morpholine-2,4-dicarboxylate, 98%, O4-tert-butyl O2-methyl (2S)-morpholine-2,4-dicarboxylate, >97%, >97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
4-O-tert-butyl 2-O-methyl (2S)-morpholine-2,4-dicarboxylate (CAS 1932484-68-8) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl (2S)-morpholine-2,4-dicarboxylate. InChIKey: RZIYWKZWSSFEFI-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-methyl (2S)-morpholine-2,4-dicarboxylate |
| InChIKey | RZIYWKZWSSFEFI-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)C(=O)OC |
Computed by PubChem (NCBI)