CAS 1932506-72-3 is the registry number for (S)-1-(2-Chloro-5-fluorophenyl)ethanol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-1-(2-chloro-5-fluorophenyl)ethanol (CAS 1932506-72-3) is a chemical compound with the molecular formula C8H8ClFO and a molecular weight of 174.60 g/mol. IUPAC name: (1S)-1-(2-chloro-5-fluorophenyl)ethanol. InChIKey: FIYGPNJJPRDZHO-YFKPBYRVSA-N.
| Molecular formula | C8H8ClFO |
|---|---|
| Molecular weight | 174.60 g/mol |
| IUPAC name | (1S)-1-(2-chloro-5-fluorophenyl)ethanol |
| InChIKey | FIYGPNJJPRDZHO-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)F)Cl)O |
Computed by PubChem (NCBI)