CAS 1932509-22-2 is the registry number for (4AS,8aS)-6-methyloctahydro-1H-pyrido[3,4-b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aS,8aS)-6-methyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine (CAS 1932509-22-2) is a chemical compound with the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. IUPAC name: (4aS,8aS)-6-methyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine. InChIKey: KIWLWZVAJKNLOX-YUMQZZPRSA-N.
| Molecular formula | C8H16N2O |
|---|---|
| Molecular weight | 156.23 g/mol |
| IUPAC name | (4aS,8aS)-6-methyl-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine |
| InChIKey | KIWLWZVAJKNLOX-YUMQZZPRSA-N |
| SMILES | CN1CC[C@H]2[C@H](C1)OCCN2 |
Computed by PubChem (NCBI)