CAS 1932540-17-4 is the registry number for (1R,2R,6R)-7,7-Difluorobicyclo[4.1.0]heptan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,6R)-7,7-difluorobicyclo[4.1.0]heptan-2-ol (CAS 1932540-17-4) is a chemical compound with the molecular formula C7H10F2O and a molecular weight of 148.15 g/mol. IUPAC name: (1R,2R,6R)-7,7-difluorobicyclo[4.1.0]heptan-2-ol. InChIKey: GHDRQAQSUKXFLI-HSUXUTPPSA-N.
| Molecular formula | C7H10F2O |
|---|---|
| Molecular weight | 148.15 g/mol |
| IUPAC name | (1R,2R,6R)-7,7-difluorobicyclo[4.1.0]heptan-2-ol |
| InChIKey | GHDRQAQSUKXFLI-HSUXUTPPSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2(F)F)[C@@H](C1)O |
Computed by PubChem (NCBI)