Products 1932571-29-3
CAS 1932571-29-3 is the registry number for Cis-(3-(trifluoromethyl)piperidin-2-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
[(2S,3R)-3-(trifluoromethyl)piperidin-2-yl]methanol (CAS 1932571-29-3) is a chemical compound with the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. IUPAC name: [(2S,3R)-3-(trifluoromethyl)piperidin-2-yl]methanol. InChIKey: BUZAVNCLKBQJAT-PHDIDXHHSA-N.
| Molecular formula | C7H12F3NO |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | [(2S,3R)-3-(trifluoromethyl)piperidin-2-yl]methanol |
| InChIKey | BUZAVNCLKBQJAT-PHDIDXHHSA-N |
| SMILES | C1C[C@H]([C@H](NC1)CO)C(F)(F)F |
Computed by PubChem (NCBI)