CAS 1932581-59-3 is the registry number for (2R,3R)-3-Fluoroazetidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-3-fluoroazetidine-2-carboxylic acid (CAS 1932581-59-3) is a chemical compound with the molecular formula C4H6FNO2 and a molecular weight of 119.09 g/mol. IUPAC name: (2R,3R)-3-fluoroazetidine-2-carboxylic acid. InChIKey: JLUJKKAXZDOQQF-GBXIJSLDSA-N.
| Molecular formula | C4H6FNO2 |
|---|---|
| Molecular weight | 119.09 g/mol |
| IUPAC name | (2R,3R)-3-fluoroazetidine-2-carboxylic acid |
| InChIKey | JLUJKKAXZDOQQF-GBXIJSLDSA-N |
| SMILES | C1[C@H]([C@H](N1)C(=O)O)F |
Computed by PubChem (NCBI)