CAS 1932598-55-4 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-iodobutanoic acid, 98%, Fmoc-Abu(I)-OH 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 25mg, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoic acid (CAS 1932598-55-4) is a chemical compound with the molecular formula C19H18INO4 and a molecular weight of 451.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoic acid. InChIKey: WUMHLUDKFHNQNJ-KRWDZBQOSA-N.
| Molecular formula | C19H18INO4 |
|---|---|
| Molecular weight | 451.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoic acid |
| InChIKey | WUMHLUDKFHNQNJ-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCI)C(=O)O |
Computed by PubChem (NCBI)