CAS 1932782-90-5 is the registry number for (1R,2R)-2-Amino-4,4-difluorocyclopentan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-amino-4,4-difluorocyclopentan-1-ol (CAS 1932782-90-5) is a chemical compound with the molecular formula C5H9F2NO and a molecular weight of 137.13 g/mol. IUPAC name: trans-(1R,2R)-2-amino-4,4-difluorocyclopentan-1-ol. InChIKey: CIDGQJFAPODFAK-QWWZWVQMSA-N.
| Molecular formula | C5H9F2NO |
|---|---|
| Molecular weight | 137.13 g/mol |
| IUPAC name | trans-(1R,2R)-2-amino-4,4-difluorocyclopentan-1-ol |
| InChIKey | CIDGQJFAPODFAK-QWWZWVQMSA-N |
| SMILES | C1[C@H]([C@@H](CC1(F)F)O)N |
Computed by PubChem (NCBI)