Products 1933473-39-2
CAS 1933473-39-2 is the registry number for 2-(2,2,2-Trifluoroethyl)-3-pyridinecarboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2,2,2-trifluoroethyl)pyridine-3-carboxylic acid (CAS 1933473-39-2) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)pyridine-3-carboxylic acid. InChIKey: OGHJITBWRWULBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethyl)pyridine-3-carboxylic acid |
| InChIKey | OGHJITBWRWULBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)