CAS 19335-15-0 is the registry number for 1H-Indazole-3,5-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1H-indazole-3,5-diamine;hydrochloride (CAS 19335-15-0) is a chemical compound with the molecular formula C7H9ClN4 and a molecular weight of 184.62 g/mol. IUPAC name: 1H-indazole-3,5-diamine;hydrochloride. InChIKey: FFIWUFJWBJFPRO-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN4 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1H-indazole-3,5-diamine;hydrochloride |
| InChIKey | FFIWUFJWBJFPRO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=NN2)N.Cl |
Computed by PubChem (NCBI)