Products 1933529-19-1
CAS 1933529-19-1 is the registry number for (2-(tert-Butyl)-4-(3-chlorophenyl)thiazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-tert-butyl-4-(3-chlorophenyl)-1,3-thiazol-5-yl]methanol (CAS 1933529-19-1) is a chemical compound with the molecular formula C14H16ClNOS and a molecular weight of 281.8 g/mol. IUPAC name: [2-tert-butyl-4-(3-chlorophenyl)-1,3-thiazol-5-yl]methanol. InChIKey: BHUGBVPQUWTCEZ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNOS |
|---|---|
| Molecular weight | 281.8 g/mol |
| IUPAC name | [2-tert-butyl-4-(3-chlorophenyl)-1,3-thiazol-5-yl]methanol |
| InChIKey | BHUGBVPQUWTCEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=C(S1)CO)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)