CAS 193410-84-3 appears in our catalog under these names: Zeylenone, Zeylenone, 98.0%, 98.0%, Zeylenone, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
[(1S,5R,6S)-5-benzoyloxy-1,6-dihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate (CAS 193410-84-3) is a chemical compound with the molecular formula C21H18O7 and a molecular weight of 382.4 g/mol. IUPAC name: [(1S,5R,6S)-5-benzoyloxy-1,6-dihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate. InChIKey: UUNZIGRBVXAOSR-PLMTUMEDSA-N.
| Molecular formula | C21H18O7 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | [(1S,5R,6S)-5-benzoyloxy-1,6-dihydroxy-2-oxocyclohex-3-en-1-yl]methyl benzoate |
| InChIKey | UUNZIGRBVXAOSR-PLMTUMEDSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@]2([C@H]([C@@H](C=CC2=O)OC(=O)C3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)