Products 1934370-64-5
CAS 1934370-64-5 is the registry number for 1-(5-Methyl-1H-pyrazol-3-yl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-methyl-1H-pyrazol-3-yl)pyrrolidine-3-carboxylic acid (CAS 1934370-64-5) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: 1-(5-methyl-1H-pyrazol-3-yl)pyrrolidine-3-carboxylic acid. InChIKey: MBQSIQVOZOJLRA-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1-(5-methyl-1H-pyrazol-3-yl)pyrrolidine-3-carboxylic acid |
| InChIKey | MBQSIQVOZOJLRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)N2CCC(C2)C(=O)O |
Computed by PubChem (NCBI)