Products 1934404-92-8

CAS 1934404-92-8 appears in our catalog under these names: 3-Methoxy-1,2-thiazole-5-sulfonyl chloride, 95%, 3-Methoxy-1,2-thiazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3-methoxy-1,2-thiazole-5-sulfonyl chloride (CAS 1934404-92-8) is a chemical compound with the molecular formula C4H4ClNO3S2 and a molecular weight of 213.7 g/mol. IUPAC name: 3-methoxy-1,2-thiazole-5-sulfonyl chloride. InChIKey: NSPBFOPYGWNPOR-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4ClNO3S2
Molecular weight213.7 g/mol
IUPAC name3-methoxy-1,2-thiazole-5-sulfonyl chloride
InChIKeyNSPBFOPYGWNPOR-UHFFFAOYSA-N
SMILESCOC1=NSC(=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)