CAS 1934652-54-6 appears in our catalog under these names: 5-Cyanopyridine-2-sulfonyl fluoride, 95%, 5-Cyanopyridine-2-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-cyanopyridine-2-sulfonyl fluoride (CAS 1934652-54-6) is a chemical compound with the molecular formula C6H3FN2O2S and a molecular weight of 186.17 g/mol. IUPAC name: 5-cyanopyridine-2-sulfonyl fluoride. InChIKey: BRZNLTDLGANTTI-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O2S |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 5-cyanopyridine-2-sulfonyl fluoride |
| InChIKey | BRZNLTDLGANTTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C#N)S(=O)(=O)F |
Computed by PubChem (NCBI)