Products 1934756-61-2

CAS 1934756-61-2 is the registry number for 1-(Dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid (CAS 1934756-61-2) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: 1-(dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid. InChIKey: JRFIVTYDVNJZFK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2
Molecular weight171.24 g/mol
IUPAC name1-(dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid
InChIKeyJRFIVTYDVNJZFK-UHFFFAOYSA-N
SMILESCC1(CC(C1)(C(=O)O)N(C)C)C

Computed by PubChem (NCBI)