CAS 1934756-61-2 is the registry number for 1-(Dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid (CAS 1934756-61-2) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: 1-(dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid. InChIKey: JRFIVTYDVNJZFK-UHFFFAOYSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 1-(dimethylamino)-3,3-dimethylcyclobutane-1-carboxylic acid |
| InChIKey | JRFIVTYDVNJZFK-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)(C(=O)O)N(C)C)C |
Computed by PubChem (NCBI)