Products 1934783-95-5

CAS 1934783-95-5 is the registry number for 1-Acetyl-6-methylpiperidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-acetyl-6-methylpiperidine-3-carboxylic acid (CAS 1934783-95-5) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 1-acetyl-6-methylpiperidine-3-carboxylic acid. InChIKey: TUVNLNCPOVYADC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO3
Molecular weight185.22 g/mol
IUPAC name1-acetyl-6-methylpiperidine-3-carboxylic acid
InChIKeyTUVNLNCPOVYADC-UHFFFAOYSA-N
SMILESCC1CCC(CN1C(=O)C)C(=O)O

Computed by PubChem (NCBI)