CAS 1934829-97-6 is the registry number for 5-Bromo-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)pyridine (CAS 1934829-97-6) is a chemical compound with the molecular formula C9H8BrClF2N2 and a molecular weight of 297.53 g/mol. IUPAC name: 5-bromo-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)pyridine. InChIKey: KEMLWDUUOJTPNO-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClF2N2 |
|---|---|
| Molecular weight | 297.53 g/mol |
| IUPAC name | 5-bromo-3-chloro-2-(3,3-difluoropyrrolidin-1-yl)pyridine |
| InChIKey | KEMLWDUUOJTPNO-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)C2=C(C=C(C=N2)Br)Cl |
Computed by PubChem (NCBI)