CAS 1934830-95-1 is the registry number for 2-(4-Chloro-3-fluorophenyl)malononitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
2-(4-chloro-3-fluorophenyl)propanedinitrile (CAS 1934830-95-1) is a chemical compound with the molecular formula C9H4ClFN2 and a molecular weight of 194.59 g/mol. IUPAC name: 2-(4-chloro-3-fluorophenyl)propanedinitrile. InChIKey: QELUXWDGOPODKO-UHFFFAOYSA-N.
| Molecular formula | C9H4ClFN2 |
|---|---|
| Molecular weight | 194.59 g/mol |
| IUPAC name | 2-(4-chloro-3-fluorophenyl)propanedinitrile |
| InChIKey | QELUXWDGOPODKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C#N)C#N)F)Cl |
Computed by PubChem (NCBI)