CAS 1934855-95-4 is the registry number for 5-Bromo-1-(pyridin-3-yl)pyridin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-1-pyridin-3-ylpyridin-2-one (CAS 1934855-95-4) is a chemical compound with the molecular formula C10H7BrN2O and a molecular weight of 251.08 g/mol. IUPAC name: 5-bromo-1-pyridin-3-ylpyridin-2-one. InChIKey: IBTRNGBWTWNQGY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-bromo-1-pyridin-3-ylpyridin-2-one |
| InChIKey | IBTRNGBWTWNQGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)N2C=C(C=CC2=O)Br |
Computed by PubChem (NCBI)