Products 1934919-78-4

CAS 1934919-78-4 is the registry number for 5-Iodo-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-iodo-1H-imidazole-4-carboxylic acid (CAS 1934919-78-4) is a chemical compound with the molecular formula C4H3IN2O2 and a molecular weight of 237.98 g/mol. IUPAC name: 5-iodo-1H-imidazole-4-carboxylic acid. InChIKey: RBBNNWXODBWDLM-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3IN2O2
Molecular weight237.98 g/mol
IUPAC name5-iodo-1H-imidazole-4-carboxylic acid
InChIKeyRBBNNWXODBWDLM-UHFFFAOYSA-N
SMILESC1=NC(=C(N1)I)C(=O)O

Computed by PubChem (NCBI)