CAS 19350-68-6 is the registry number for 4-Bromobenzaldehyde tosylhydrazone, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-[(E)-(4-bromophenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 19350-68-6) is a chemical compound with the molecular formula C14H13BrN2O2S and a molecular weight of 353.24 g/mol. IUPAC name: N-[(E)-(4-bromophenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: BPJBUIWCUYKVNL-MHWRWJLKSA-N.
| Molecular formula | C14H13BrN2O2S |
|---|---|
| Molecular weight | 353.24 g/mol |
| IUPAC name | N-[(E)-(4-bromophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | BPJBUIWCUYKVNL-MHWRWJLKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)