Products 1935083-06-9
CAS 1935083-06-9 appears in our catalog under these names: 3,5-dichloro-4-fluoro-pyridin-2-amine, 97%, 97%, 3,5-dichloro-4-fluoro-pyridin-2-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3,5-dichloro-4-fluoropyridin-2-amine (CAS 1935083-06-9) is a chemical compound with the molecular formula C5H3Cl2FN2 and a molecular weight of 180.99 g/mol. IUPAC name: 3,5-dichloro-4-fluoropyridin-2-amine. InChIKey: WZZKHZMBFVDRLM-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2FN2 |
|---|---|
| Molecular weight | 180.99 g/mol |
| IUPAC name | 3,5-dichloro-4-fluoropyridin-2-amine |
| InChIKey | WZZKHZMBFVDRLM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Cl)F)Cl |
Computed by PubChem (NCBI)