CAS 1935291-91-0 appears in our catalog under these names: 2-azaspiro[5.5]undecane-1,9-dione, 95%, 95%, 2-Azaspiro[5.5]undecane-1,9-dione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-azaspiro[5.5]undecane-1,9-dione (CAS 1935291-91-0) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: 2-azaspiro[5.5]undecane-1,9-dione. InChIKey: NCFYGEBHISIVDD-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 2-azaspiro[5.5]undecane-1,9-dione |
| InChIKey | NCFYGEBHISIVDD-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC(=O)CC2)C(=O)NC1 |
Computed by PubChem (NCBI)