CAS 1935346-20-5 appears in our catalog under these names: 6-Amino-3-bromo-5-nitro-pyridin-2-ol, 95%, 6-Amino-3-bromo-5-nitro-1h-pyridin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
6-amino-3-bromo-5-nitro-1H-pyridin-2-one (CAS 1935346-20-5) is a chemical compound with the molecular formula C5H4BrN3O3 and a molecular weight of 234.01 g/mol. IUPAC name: 6-amino-3-bromo-5-nitro-1H-pyridin-2-one. InChIKey: PCFLYUZOCFZUHZ-UHFFFAOYSA-N.
| Molecular formula | C5H4BrN3O3 |
|---|---|
| Molecular weight | 234.01 g/mol |
| IUPAC name | 6-amino-3-bromo-5-nitro-1H-pyridin-2-one |
| InChIKey | PCFLYUZOCFZUHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)