CAS 1935349-92-0 appears in our catalog under these names: 2-(Boc-amino)-5-bromoimidazo[1,2-a]pyridine, 95%, Carbamic acid, N-(5-bromoimidazo[1,2-a]pyridin-2-yl)-, 1,1-dimethylethyl ester, 97%, 97%, 2-(BOC-AMINO)-5-BROMOIMIDAZO[1,2-A]PYRIDINE, 97%, tert-Butyl (5-bromoimidazo[1,2-a]pyridin-2-yl)carbamate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 5g, 10g, 25g, 100mg.
Tert-butyl N-(5-bromoimidazo[1,2-a]pyridin-2-yl)carbamate (CAS 1935349-92-0) is a chemical compound with the molecular formula C12H14BrN3O2 and a molecular weight of 312.16 g/mol. IUPAC name: tert-butyl N-(5-bromoimidazo[1,2-a]pyridin-2-yl)carbamate. InChIKey: YETVWHXKIRPRJC-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3O2 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | tert-butyl N-(5-bromoimidazo[1,2-a]pyridin-2-yl)carbamate |
| InChIKey | YETVWHXKIRPRJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN2C(=N1)C=CC=C2Br |
Computed by PubChem (NCBI)