Products 1935350-63-2

CAS 1935350-63-2 is the registry number for 3,5-Dichloro-1,2,4-triazine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3,5-dichloro-1,2,4-triazine-6-carboxylic acid (CAS 1935350-63-2) is a chemical compound with the molecular formula C4HCl2N3O2 and a molecular weight of 193.97 g/mol. IUPAC name: 3,5-dichloro-1,2,4-triazine-6-carboxylic acid. InChIKey: SFGOEFILFNSCSU-UHFFFAOYSA-N.

Identity
Molecular formulaC4HCl2N3O2
Molecular weight193.97 g/mol
IUPAC name3,5-dichloro-1,2,4-triazine-6-carboxylic acid
InChIKeySFGOEFILFNSCSU-UHFFFAOYSA-N
SMILESC1(=C(N=C(N=N1)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)