Products 1935366-54-3
CAS 1935366-54-3 appears in our catalog under these names: 4-Bromo-5-methyl-2,3-dihydro-1H-indol-2-one, 4-bromo-5-methyl-2,3-dihydro-1H-indol-2-one, 97%, 97%, 4-Bromo-5-methylindolin-2-one, 97%, 4-bromo-5-methyl-2,3-dihydro-1H-indol-2-one, 97%. Offered by: Biosynth, Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 5g, 100g, 1g, 25g.
4-bromo-5-methyl-1,3-dihydroindol-2-one (CAS 1935366-54-3) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 4-bromo-5-methyl-1,3-dihydroindol-2-one. InChIKey: BVZQFQZCSVIIJE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 4-bromo-5-methyl-1,3-dihydroindol-2-one |
| InChIKey | BVZQFQZCSVIIJE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=O)C2)Br |
Computed by PubChem (NCBI)