CAS 1935424-19-3 is the registry number for 2-(1-Bromoethyl)-4-(trifluoromethyl)thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-bromoethyl)-4-(trifluoromethyl)-1,3-thiazole (CAS 1935424-19-3) is a chemical compound with the molecular formula C6H5BrF3NS and a molecular weight of 260.08 g/mol. IUPAC name: 2-(1-bromoethyl)-4-(trifluoromethyl)-1,3-thiazole. InChIKey: UQLWKOUNGWKCLC-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF3NS |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 2-(1-bromoethyl)-4-(trifluoromethyl)-1,3-thiazole |
| InChIKey | UQLWKOUNGWKCLC-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CS1)C(F)(F)F)Br |
Computed by PubChem (NCBI)