Products 1935541-85-7
CAS 1935541-85-7 is the registry number for 4-Bromo-1-methyl-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
4-bromo-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one (CAS 1935541-85-7) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 4-bromo-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: ISOCZSVWMIMQSR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 4-bromo-1-methyl-3H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | ISOCZSVWMIMQSR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C(C=CN=C21)Br |
Computed by PubChem (NCBI)