CAS 1935561-34-4 appears in our catalog under these names: 5-Bromo-2-iodo-4-(trifluoromethyl)-1,3-thiazole, 5-Bromo-2-iodo-4-(trifluoromethyl)-1,3-thiazole, 97%, 5-Bromo-2-iodo-4-(trifluoromethyl)-1,3-thiazole, 97%, 97%. Offered by: Biosynth, AmBeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg, 500mg.
5-bromo-2-iodo-4-(trifluoromethyl)-1,3-thiazole (CAS 1935561-34-4) is a chemical compound with the molecular formula C4BrF3INS and a molecular weight of 357.92 g/mol. IUPAC name: 5-bromo-2-iodo-4-(trifluoromethyl)-1,3-thiazole. InChIKey: DNMDYLHWMLNGGF-UHFFFAOYSA-N.
| Molecular formula | C4BrF3INS |
|---|---|
| Molecular weight | 357.92 g/mol |
| IUPAC name | 5-bromo-2-iodo-4-(trifluoromethyl)-1,3-thiazole |
| InChIKey | DNMDYLHWMLNGGF-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)I)Br)C(F)(F)F |
Computed by PubChem (NCBI)