CAS 1935614-24-6 is the registry number for 1-(2-Bromo-5-(trifluoromethyl)thiazol-4-yl)ethan-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-bromo-5-(trifluoromethyl)-1,3-thiazol-4-yl]ethanone (CAS 1935614-24-6) is a chemical compound with the molecular formula C6H3BrF3NOS and a molecular weight of 274.06 g/mol. IUPAC name: 1-[2-bromo-5-(trifluoromethyl)-1,3-thiazol-4-yl]ethanone. InChIKey: PLYPXITUZNMDJS-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NOS |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 1-[2-bromo-5-(trifluoromethyl)-1,3-thiazol-4-yl]ethanone |
| InChIKey | PLYPXITUZNMDJS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(SC(=N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)