CAS 1935893-03-0 is the registry number for 2-(4-Bromo-3-chlorophenoxy)pyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(4-bromo-3-chlorophenoxy)pyrimidine (CAS 1935893-03-0) is a chemical compound with the molecular formula C10H6BrClN2O and a molecular weight of 285.52 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenoxy)pyrimidine. InChIKey: AHXGMXCIPLCEDM-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O |
|---|---|
| Molecular weight | 285.52 g/mol |
| IUPAC name | 2-(4-bromo-3-chlorophenoxy)pyrimidine |
| InChIKey | AHXGMXCIPLCEDM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)OC2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)