CAS 19359-16-1 is the registry number for N-Mesityl-3-oxobutanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-oxo-N-(2,4,6-trimethylphenyl)butanamide (CAS 19359-16-1) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 3-oxo-N-(2,4,6-trimethylphenyl)butanamide. InChIKey: GVBDGMRNGLFNRS-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 3-oxo-N-(2,4,6-trimethylphenyl)butanamide |
| InChIKey | GVBDGMRNGLFNRS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)CC(=O)C)C |
Computed by PubChem (NCBI)