CAS 1935952-61-6 appears in our catalog under these names: 5-Bromo-2-chloroisonicotinoyl chloride, 95%, 5-Bromo-2-chloroisonicotinoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-2-chloropyridine-4-carbonyl chloride (CAS 1935952-61-6) is a chemical compound with the molecular formula C6H2BrCl2NO and a molecular weight of 254.89 g/mol. IUPAC name: 5-bromo-2-chloropyridine-4-carbonyl chloride. InChIKey: RVASMDWQSBZSBU-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO |
|---|---|
| Molecular weight | 254.89 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-4-carbonyl chloride |
| InChIKey | RVASMDWQSBZSBU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Br)C(=O)Cl |
Computed by PubChem (NCBI)