CAS 1935989-83-5 is the registry number for N,N-Bis-boc-2-bromo-3-methoxy-phenylamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-(2-bromo-3-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1935989-83-5) is a chemical compound with the molecular formula C17H24BrNO5 and a molecular weight of 402.3 g/mol. IUPAC name: tert-butyl N-(2-bromo-3-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: PAVPSQXQAYHBRR-UHFFFAOYSA-N.
| Molecular formula | C17H24BrNO5 |
|---|---|
| Molecular weight | 402.3 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-3-methoxyphenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | PAVPSQXQAYHBRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C(=CC=C1)OC)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)