Products 193603-94-0
CAS 193603-94-0 appears in our catalog under these names: Indomethacin Impurity 19, Indomethacin 1-Menthol ester, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 250mg.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 193603-94-0) is a chemical compound with the molecular formula C29H34ClNO4 and a molecular weight of 496.0 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: RSBMDLAATWEXQU-NAWOXDROSA-N.
| Molecular formula | C29H34ClNO4 |
|---|---|
| Molecular weight | 496.0 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | RSBMDLAATWEXQU-NAWOXDROSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CC2=C(N(C3=C2C=C(C=C3)OC)C(=O)C4=CC=C(C=C4)Cl)C)C(C)C |
Computed by PubChem (NCBI)