CAS 1936200-75-7 is the registry number for 1–(4–fluorophenyl)–2–(triMethylsilyl)ethanol. Offered by: GLPBio. Available pack sizes: 200mg.
1-(4-fluorophenyl)-2-trimethylsilylethanol (CAS 1936200-75-7) is a chemical compound with the molecular formula C11H17FOSi and a molecular weight of 212.33 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-trimethylsilylethanol. InChIKey: BAEWTUMOVQUONF-UHFFFAOYSA-N.
| Molecular formula | C11H17FOSi |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-trimethylsilylethanol |
| InChIKey | BAEWTUMOVQUONF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CC(C1=CC=C(C=C1)F)O |
Computed by PubChem (NCBI)